C32H53NO2 — CID 155097706
[(3S,5R,10S,13R,14R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminoacetate (PubChem CID 155097706) has the molecular formula C32H53NO2 and a molecular weight of 483.78 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminoacetate.
| Compound Name | [(3S,5R,10S,13R,14R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 155097706 |
| Molecular Formula | C32H53NO2 |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 483.41 |
| IUPAC Name | [(3S,5R,10S,13R,14R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-aminoacetate |
| SMILES | CC(C)=CCC[C@@H](C)C1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)CN)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H53NO2/c1-21(2)10-9-11-22(3)23-14-18-32(8)25-12-13-26-29(4,5)27(35-28(34)20-33)16-17-30(26,6)24(25)15-19-31(23,32)7/h10,22-23,26-27H,9,11-20,33H2,1-8H3/t22-,23?,26+,27+,30-,31-,32+/m1/s1 |
| InChIKey | FNMSGTAIKSDZPC-CXKZXXEBSA-N |
| XLogP | 7.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|