C34H51NO3 — CID 139425414
[(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2-oxazole-5-carboxylate (PubChem CID 139425414) has the molecular formula C34H51NO3 and a molecular weight of 521.79 g/mol. Its IUPAC name is [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2-oxazole-5-carboxylate.
| Compound Name | [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 139425414 |
| Molecular Formula | C34H51NO3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | [(3S,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 1,2-oxazole-5-carboxylate |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)c2ccno2)C(C)(C)C1CC3 |
| InChI | InChI=1S/C34H51NO3/c1-22(2)10-9-11-23(3)24-14-19-34(8)26-12-13-28-31(4,5)29(37-30(36)27-17-21-35-38-27)16-18-32(28,6)25(26)15-20-33(24,34)7/h10,17,21,23-24,28-29H,9,11-16,18-20H2,1-8H3/t23-,24-,28?,29+,32-,33-,34+/m1/s1 |
| InChIKey | UIQKEUVHEFJNGZ-OGOWPYMSSA-N |
| XLogP | 9.33 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|