C37H56O3 — CID 67924621
[(3S,9R,10R,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 67924621) has the molecular formula C37H56O3 and a molecular weight of 548.85 g/mol. Its IUPAC name is [(3S,9R,10R,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,9R,10R,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 67924621 |
| Molecular Formula | C37H56O3 |
| Molecular Weight | 548.85 g/mol |
| Exact Mass | 548.42 |
| IUPAC Name | [(3S,9R,10R,13R,14R,15S,17R)-15-hydroxy-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1C[C@H](O)[C@@]2(C)C3=CCC4C(C)(C)[C@@H](OC(=O)c5ccccc5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C37H56O3/c1-24(2)13-12-14-25(3)29-23-31(38)37(8)28-17-18-30-34(4,5)32(40-33(39)26-15-10-9-11-16-26)20-21-35(30,6)27(28)19-22-36(29,37)7/h9-11,15-17,24-25,27,29-32,38H,12-14,18-23H2,1-8H3/t25-,27+,29-,30?,31+,32+,35-,36-,37-/m1/s1 |
| InChIKey | NOUVGDJUUVKFFW-XUKOYULASA-N |
| XLogP | 9.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.85 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|