C31H52O3 — CID 14889276
methyl (3S,5R,9R,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate (PubChem CID 14889276) has the molecular formula C31H52O3 and a molecular weight of 472.75 g/mol. Its IUPAC name is methyl (3S,5R,9R,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate.
| Compound Name | methyl (3S,5R,9R,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate |
|---|---|
| PubChem CID | 14889276 |
| Molecular Formula | C31H52O3 |
| Molecular Weight | 472.75 g/mol |
| Exact Mass | 472.39 |
| IUPAC Name | methyl (3S,5R,9R,10R,13R,14S,17R)-3-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-14-carboxylate |
| SMILES | COC(=O)[C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@H]1C2=CC[C@H]2C(C)(C)[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C31H52O3/c1-20(2)10-9-11-21(3)22-15-19-31(27(33)34-8)24-12-13-25-28(4,5)26(32)16-17-29(25,6)23(24)14-18-30(22,31)7/h12,20-23,25-26,32H,9-11,13-19H2,1-8H3/t21-,22-,23+,25+,26+,29-,30-,31+/m1/s1 |
| InChIKey | NIXJPSUDRMONAL-XRPBSQEFSA-N |
| XLogP | 7.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.75 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|