C32H52O — CID 14015390
(3S,5R,9R,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-14-prop-2-ynyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 14015390) has the molecular formula C32H52O and a molecular weight of 452.77 g/mol. Its IUPAC name is (3S,5R,9R,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-14-prop-2-ynyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5R,9R,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-14-prop-2-ynyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 14015390 |
| Molecular Formula | C32H52O |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.40 |
| IUPAC Name | (3S,5R,9R,10R,13R,14S,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-14-prop-2-ynyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C#CC[C@@]12CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC[C@H]1C2=CC[C@H]2C(C)(C)[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C32H52O/c1-9-18-32-21-16-24(23(4)12-10-11-22(2)3)31(32,8)20-15-25-26(32)13-14-27-29(5,6)28(33)17-19-30(25,27)7/h1,13,22-25,27-28,33H,10-12,14-21H2,2-8H3/t23-,24-,25+,27+,28+,30-,31-,32+/m1/s1 |
| InChIKey | CTIFFQDSXOVIKN-SWOUMNRASA-N |
| XLogP | 8.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|