C29H50O2 — CID 67856977
(3S,5S,9R,10S,13R,14R,15R,17R)-3-methoxy-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-ol (PubChem CID 67856977) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is (3S,5S,9R,10S,13R,14R,15R,17R)-3-methoxy-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-ol.
| Compound Name | (3S,5S,9R,10S,13R,14R,15R,17R)-3-methoxy-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-ol |
|---|---|
| PubChem CID | 67856977 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | (3S,5S,9R,10S,13R,14R,15R,17R)-3-methoxy-10,13,14-trimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-15-ol |
| SMILES | CO[C@H]1CC[C@@]2(C)[C@@H](CC=C3[C@@H]2CC[C@]2(C)[C@@H]([C@H](C)CCCC(C)C)C[C@@H](O)[C@@]32C)C1 |
| InChI | InChI=1S/C29H50O2/c1-19(2)9-8-10-20(3)25-18-26(30)29(6)24-12-11-21-17-22(31-7)13-15-27(21,4)23(24)14-16-28(25,29)5/h12,19-23,25-26,30H,8-11,13-18H2,1-7H3/t20-,21+,22+,23+,25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | CPFQTKVCVOLITE-OPURCUKASA-N |
| XLogP | 7.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|