C36H52O3 — CID 139936814
[(3S,5R,10S,13R,14S,15R,17R)-15-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 139936814) has the molecular formula C36H52O3 and a molecular weight of 532.81 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14S,15R,17R)-15-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5R,10S,13R,14S,15R,17R)-15-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 139936814 |
| Molecular Formula | C36H52O3 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | [(3S,5R,10S,13R,14S,15R,17R)-15-hydroxy-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1C[C@@H](O)[C@@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)c2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C36H52O3/c1-23(2)12-11-13-24(3)28-22-29(37)32-26-16-17-30-34(4,5)31(39-33(38)25-14-9-8-10-15-25)19-21-35(30,6)27(26)18-20-36(28,32)7/h8-10,12,14-15,24,28-32,37H,11,13,16-22H2,1-7H3/t24-,28-,29-,30+,31+,32+,35-,36-/m1/s1 |
| InChIKey | KEJSAPCKSYZYHH-NUYNFQOKSA-N |
| XLogP | 8.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|