C37H52O2 — CID 142026479
[(2S,5S,12S,16R)-2,6,6,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-5-tetracyclo[9.7.0.02,8.012,16]octadeca-1(11),13-dienyl] benzoate (PubChem CID 142026479) has the molecular formula C37H52O2 and a molecular weight of 528.82 g/mol. Its IUPAC name is [(2S,5S,12S,16R)-2,6,6,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-5-tetracyclo[9.7.0.02,8.012,16]octadeca-1(11),13-dienyl] benzoate.
| Compound Name | [(2S,5S,12S,16R)-2,6,6,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-5-tetracyclo[9.7.0.02,8.012,16]octadeca-1(11),13-dienyl] benzoate |
|---|---|
| PubChem CID | 142026479 |
| Molecular Formula | C37H52O2 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.40 |
| IUPAC Name | [(2S,5S,12S,16R)-2,6,6,16-tetramethyl-15-(6-methylhept-5-en-2-yl)-5-tetracyclo[9.7.0.02,8.012,16]octadeca-1(11),13-dienyl] benzoate |
| SMILES | CC(C)=CCCC(C)C1C=C[C@@H]2C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](OC(=O)c2ccccc2)C(C)(C)CC1CC3 |
| InChI | InChI=1S/C37H52O2/c1-25(2)12-11-13-26(3)30-18-19-31-29-17-16-28-24-35(4,5)33(39-34(38)27-14-9-8-10-15-27)21-23-36(28,6)32(29)20-22-37(30,31)7/h8-10,12,14-15,18-19,26,28,30-31,33H,11,13,16-17,20-24H2,1-7H3/t26?,28?,30?,31-,33+,36+,37-/m1/s1 |
| InChIKey | RTYPZYWQSJGHBR-CBNKYKNPSA-N |
| XLogP | 10.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|