C35H50 — CID 141028780
(3S,5S,10S,13R,14S,17S)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-3-phenyl-1,2,3,5,6,7,11,12,14,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 141028780) has the molecular formula C35H50 and a molecular weight of 470.79 g/mol. Its IUPAC name is (3S,5S,10S,13R,14S,17S)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-3-phenyl-1,2,3,5,6,7,11,12,14,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,5S,10S,13R,14S,17S)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-3-phenyl-1,2,3,5,6,7,11,12,14,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 141028780 |
| Molecular Formula | C35H50 |
| Molecular Weight | 470.79 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | (3S,5S,10S,13R,14S,17S)-4,4,10,13-tetramethyl-17-[(2R)-6-methylhept-5-en-2-yl]-3-phenyl-1,2,3,5,6,7,11,12,14,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CC(C)=CCC[C@@H](C)[C@H]1C=C[C@@H]2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](c2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C35H50/c1-24(2)12-11-13-25(3)28-17-18-30-27-16-19-32-33(4,5)29(26-14-9-8-10-15-26)20-23-35(32,7)31(27)21-22-34(28,30)6/h8-10,12,14-15,17-18,25,28-30,32H,11,13,16,19-23H2,1-7H3/t25-,28-,29-,30-,32+,34-,35-/m1/s1 |
| InChIKey | PWVKWHUZBVFGTN-VHZKDCPASA-N |
| XLogP | 10.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.79 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|