C30H46O2 — CID 70191755
cyclohexyl (4R)-4-[(10S,13R,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 70191755) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is cyclohexyl (4R)-4-[(10S,13R,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | cyclohexyl (4R)-4-[(10S,13R,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 70191755 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | cyclohexyl (4R)-4-[(10S,13R,14S,17S)-10,13-dimethyl-2,3,4,5,6,7,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C[C@H](CCC(=O)OC1CCCCC1)[C@H]1C=C[C@@H]2C3=C(CC[C@@]21C)[C@@]1(C)CCCCC1CC3 |
| InChI | InChI=1S/C30H46O2/c1-21(12-17-28(31)32-23-10-5-4-6-11-23)25-15-16-26-24-14-13-22-9-7-8-19-29(22,2)27(24)18-20-30(25,26)3/h15-16,21-23,25-26H,4-14,17-20H2,1-3H3/t21-,22?,25-,26-,29+,30-/m1/s1 |
| InChIKey | OUDASRBQOPYKPA-BPKDILFGSA-N |
| XLogP | 8.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|