C31H42O2 — CID 141021743
benzyl (4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 141021743) has the molecular formula C31H42O2 and a molecular weight of 446.68 g/mol. Its IUPAC name is benzyl (4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | benzyl (4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 141021743 |
| Molecular Formula | C31H42O2 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | benzyl (4R)-4-[(10S,13R,17R)-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C[C@H](CCC(=O)OCc1ccccc1)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CCCCC1CC3 |
| InChI | InChI=1S/C31H42O2/c1-22(12-17-29(32)33-21-23-9-5-4-6-10-23)26-15-16-27-25-14-13-24-11-7-8-19-30(24,2)28(25)18-20-31(26,27)3/h4-6,9-10,16,22,24,26H,7-8,11-15,17-21H2,1-3H3/t22-,24?,26-,30+,31-/m1/s1 |
| InChIKey | ABUGHKUGUYMBSY-QTCROWDTSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |