C29H40O — CID 174430785
(3S,5S,10S,13R,17R)-10,13-dimethyl-17-[1-(3-methylphenyl)propan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 174430785) has the molecular formula C29H40O and a molecular weight of 404.64 g/mol. Its IUPAC name is (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[1-(3-methylphenyl)propan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[1-(3-methylphenyl)propan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 174430785 |
| Molecular Formula | C29H40O |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-[1-(3-methylphenyl)propan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | Cc1cccc(CC(C)[C@H]2CC=C3C4=C(CC[C@@]32C)[C@@]2(C)CC[C@H](O)C[C@@H]2CC4)c1 |
| InChI | InChI=1S/C29H40O/c1-19-6-5-7-21(16-19)17-20(2)25-10-11-26-24-9-8-22-18-23(30)12-14-28(22,3)27(24)13-15-29(25,26)4/h5-7,11,16,20,22-23,25,30H,8-10,12-15,17-18H2,1-4H3/t20?,22-,23-,25+,28-,29+/m0/s1 |
| InChIKey | ZOUQNQJRKMLOQF-PNOGGLLSSA-N |
| XLogP | 7.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |