C28H38O — CID 174444671
(3S,5S,10S,13R,17R)-10,13-dimethyl-17-(1-phenylpropan-2-yl)-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 174444671) has the molecular formula C28H38O and a molecular weight of 390.61 g/mol. Its IUPAC name is (3S,5S,10S,13R,17R)-10,13-dimethyl-17-(1-phenylpropan-2-yl)-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-(1-phenylpropan-2-yl)-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 174444671 |
| Molecular Formula | C28H38O |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (3S,5S,10S,13R,17R)-10,13-dimethyl-17-(1-phenylpropan-2-yl)-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(Cc1ccccc1)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C[C@@H]1CC3 |
| InChI | InChI=1S/C28H38O/c1-19(17-20-7-5-4-6-8-20)24-11-12-25-23-10-9-21-18-22(29)13-15-27(21,2)26(23)14-16-28(24,25)3/h4-8,12,19,21-22,24,29H,9-11,13-18H2,1-3H3/t19?,21-,22-,24+,27-,28+/m0/s1 |
| InChIKey | DSHHHTXXDLUTTK-URJLNWSNSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |