C24H34O — CID 141005131
(10S,13R,17R)-10,13-dimethyl-17-[(2S)-pent-3-yn-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 141005131) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is (10S,13R,17R)-10,13-dimethyl-17-[(2S)-pent-3-yn-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (10S,13R,17R)-10,13-dimethyl-17-[(2S)-pent-3-yn-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 141005131 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (10S,13R,17R)-10,13-dimethyl-17-[(2S)-pent-3-yn-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC#C[C@@H](C)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CCC(O)CC1CC3 |
| InChI | InChI=1S/C24H34O/c1-5-6-16(2)20-9-10-21-19-8-7-17-15-18(25)11-13-23(17,3)22(19)12-14-24(20,21)4/h10,16-18,20,25H,7-9,11-15H2,1-4H3/t16-,17?,18?,20-,23+,24-/m1/s1 |
| InChIKey | GXBDLAJKYAZEQY-AJUQYXPFSA-N |
| XLogP | 5.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|