C27H43ClO2 — CID 22832167
(3S,5S,10S,13R,17R)-17-[(3R,4S)-3-chloro-4-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 22832167) has the molecular formula C27H43ClO2 and a molecular weight of 435.09 g/mol. Its IUPAC name is (3S,5S,10S,13R,17R)-17-[(3R,4S)-3-chloro-4-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,10S,13R,17R)-17-[(3R,4S)-3-chloro-4-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 22832167 |
| Molecular Formula | C27H43ClO2 |
| Molecular Weight | 435.09 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | (3S,5S,10S,13R,17R)-17-[(3R,4S)-3-chloro-4-hydroxy-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)C[C@H](O)[C@H](Cl)C(C)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C[C@@H]1CC3 |
| InChI | InChI=1S/C27H43ClO2/c1-16(2)14-24(30)25(28)17(3)21-8-9-22-20-7-6-18-15-19(29)10-12-26(18,4)23(20)11-13-27(21,22)5/h9,16-19,21,24-25,29-30H,6-8,10-15H2,1-5H3/t17?,18-,19-,21+,24-,25+,26-,27+/m0/s1 |
| InChIKey | OBVYQQDUXGNCCA-OKHQCPRLSA-N |
| XLogP | 6.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.09 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|