C34H50O3 — CID 54398369
(3S,5R,10S,13R,17S)-3-(1-ethoxyethoxy)-4,4,10,13-tetramethyl-17-[(1R)-1-phenylmethoxyethyl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 54398369) has the molecular formula C34H50O3 and a molecular weight of 506.77 g/mol. Its IUPAC name is (3S,5R,10S,13R,17S)-3-(1-ethoxyethoxy)-4,4,10,13-tetramethyl-17-[(1R)-1-phenylmethoxyethyl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (3S,5R,10S,13R,17S)-3-(1-ethoxyethoxy)-4,4,10,13-tetramethyl-17-[(1R)-1-phenylmethoxyethyl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 54398369 |
| Molecular Formula | C34H50O3 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | (3S,5R,10S,13R,17S)-3-(1-ethoxyethoxy)-4,4,10,13-tetramethyl-17-[(1R)-1-phenylmethoxyethyl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CCOC(C)O[C@H]1CC[C@]2(C)C3=C(CC[C@H]2C1(C)C)C1=CC[C@H]([C@@H](C)OCc2ccccc2)[C@@]1(C)CC3 |
| InChI | InChI=1S/C34H50O3/c1-8-35-24(3)37-31-19-21-34(7)29-18-20-33(6)27(23(2)36-22-25-12-10-9-11-13-25)15-16-28(33)26(29)14-17-30(34)32(31,4)5/h9-13,16,23-24,27,30-31H,8,14-15,17-22H2,1-7H3/t23-,24?,27-,30+,31+,33-,34-/m1/s1 |
| InChIKey | VLQLAWUIWVBTAB-XCGYXWCBSA-N |
| XLogP | 8.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|