C26H40O3 — CID 70040517
ethyl 3-[(3S,10S,13R,17S)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoate (PubChem CID 70040517) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is ethyl 3-[(3S,10S,13R,17S)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoate.
| Compound Name | ethyl 3-[(3S,10S,13R,17S)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoate |
|---|---|
| PubChem CID | 70040517 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | ethyl 3-[(3S,10S,13R,17S)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C26H40O3/c1-6-29-23(28)12-8-17-7-10-19-18-9-11-21-24(2,3)22(27)14-16-26(21,5)20(18)13-15-25(17,19)4/h10,17,21-22,27H,6-9,11-16H2,1-5H3/t17-,21?,22+,25-,26-/m1/s1 |
| InChIKey | KGEVAVORRFJCQV-IAWDSNLNSA-N |
| XLogP | 5.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |