C29H47ClO — CID 70189725
(5R,10S,13R,17R)-17-[(2R)-6-chloro-6-methylheptan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 70189725) has the molecular formula C29H47ClO and a molecular weight of 447.15 g/mol. Its IUPAC name is (5R,10S,13R,17R)-17-[(2R)-6-chloro-6-methylheptan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (5R,10S,13R,17R)-17-[(2R)-6-chloro-6-methylheptan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 70189725 |
| Molecular Formula | C29H47ClO |
| Molecular Weight | 447.15 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | (5R,10S,13R,17R)-17-[(2R)-6-chloro-6-methylheptan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCCC(C)(C)Cl)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CCC(O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C29H47ClO/c1-19(9-8-16-26(2,3)30)21-11-12-22-20-10-13-24-27(4,5)25(31)15-18-29(24,7)23(20)14-17-28(21,22)6/h12,19,21,24-25,31H,8-11,13-18H2,1-7H3/t19-,21-,24+,25?,28-,29-/m1/s1 |
| InChIKey | WAOSKUCCBSOAKI-JGILWZLBSA-N |
| XLogP | 8.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.15 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|