C29H48O — CID 57043606
(3S,10S,13R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 57043606) has the molecular formula C29H48O and a molecular weight of 412.70 g/mol. Its IUPAC name is (3S,10S,13R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10S,13R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57043606 |
| Molecular Formula | C29H48O |
| Molecular Weight | 412.70 g/mol |
| Exact Mass | 412.37 |
| IUPAC Name | (3S,10S,13R,17R)-4-ethyl-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,11,12,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CCC1C2CCC3=C(CC[C@@]4(C)C3=CC[C@@H]4[C@H](C)CCCC(C)C)[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C29H48O/c1-7-21-24-12-11-22-25-14-13-23(20(4)10-8-9-19(2)3)28(25,5)17-15-26(22)29(24,6)18-16-27(21)30/h14,19-21,23-24,27,30H,7-13,15-18H2,1-6H3/t20-,21?,23-,24?,27+,28-,29+/m1/s1 |
| InChIKey | JQIHYHJMPNNTLK-HJTIFLKPSA-N |
| XLogP | 8.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.70 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |