C32H52O — CID 57143445
(2R,3R,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2-prop-2-enyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 57143445) has the molecular formula C32H52O and a molecular weight of 452.77 g/mol. Its IUPAC name is (2R,3R,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2-prop-2-enyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (2R,3R,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2-prop-2-enyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 57143445 |
| Molecular Formula | C32H52O |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.40 |
| IUPAC Name | (2R,3R,5R,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-2-prop-2-enyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C=CC[C@@H]1C[C@]2(C)C3=C(CC[C@H]2C(C)(C)[C@@H]1O)C1=CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC3 |
| InChI | InChI=1S/C32H52O/c1-9-11-23-20-32(8)27-18-19-31(7)25(22(4)13-10-12-21(2)3)15-16-26(31)24(27)14-17-28(32)30(5,6)29(23)33/h9,16,21-23,25,28-29,33H,1,10-15,17-20H2,2-8H3/t22-,23-,25-,28+,29-,31-,32-/m1/s1 |
| InChIKey | IHARZONIXROCTB-IHHVRGGBSA-N |
| XLogP | 8.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|