C32H57NOSi — CID 69412184
(4R)-4-[(3S,5R,10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentan-1-amine (PubChem CID 69412184) has the molecular formula C32H57NOSi and a molecular weight of 499.90 g/mol. Its IUPAC name is (4R)-4-[(3S,5R,10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentan-1-amine.
| Compound Name | (4R)-4-[(3S,5R,10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentan-1-amine |
|---|---|
| PubChem CID | 69412184 |
| Molecular Formula | C32H57NOSi |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 499.42 |
| IUPAC Name | (4R)-4-[(3S,5R,10S,13R,17R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentan-1-amine |
| SMILES | C[C@H](CCCN)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C32H57NOSi/c1-22(12-11-21-33)24-14-15-25-23-13-16-27-30(5,6)28(34-35(9,10)29(2,3)4)18-20-32(27,8)26(23)17-19-31(24,25)7/h15,22,24,27-28H,11-14,16-21,33H2,1-10H3/t22-,24-,27+,28+,31-,32-/m1/s1 |
| InChIKey | CHRFLVVQMOXKKT-NLUWZDHDSA-N |
| XLogP | 9.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|