C36H54O3Si — CID 70168363
[(3S,5R,10S,13R,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 70168363) has the molecular formula C36H54O3Si and a molecular weight of 562.91 g/mol. Its IUPAC name is [(3S,5R,10S,13R,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5R,10S,13R,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 70168363 |
| Molecular Formula | C36H54O3Si |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.38 |
| IUPAC Name | [(3S,5R,10S,13R,17S)-17-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](OC(=O)c2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C36H54O3Si/c1-24(39-40(9,10)33(2,3)4)27-17-18-28-26-16-19-30-34(5,6)31(38-32(37)25-14-12-11-13-15-25)21-23-36(30,8)29(26)20-22-35(27,28)7/h11-15,18,24,27,30-31H,16-17,19-23H2,1-10H3/t24-,27-,30+,31+,35-,36-/m1/s1 |
| InChIKey | KYLAHYJRESVTCG-FRYHIYKTSA-N |
| XLogP | 9.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|