C28H44O — CID 69411638
(3S,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-5-methylhex-4-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 69411638) has the molecular formula C28H44O and a molecular weight of 396.66 g/mol. Its IUPAC name is (3S,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-5-methylhex-4-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-5-methylhex-4-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 69411638 |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.34 |
| IUPAC Name | (3S,10S,13R,17R)-4,4,10,13-tetramethyl-17-[(2R)-5-methylhex-4-en-2-yl]-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC(C)=CC[C@@H](C)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C28H44O/c1-18(2)8-9-19(3)21-11-12-22-20-10-13-24-26(4,5)25(29)15-17-28(24,7)23(20)14-16-27(21,22)6/h8,12,19,21,24-25,29H,9-11,13-17H2,1-7H3/t19-,21-,24?,25+,27-,28-/m1/s1 |
| InChIKey | JIHGWQKLXHOTBV-PIDPIPLXSA-N |
| XLogP | 7.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|