C26H40O4 — CID 70139220
ethyl 2-[(3S,10S,13R,17R)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethyl carbonate (PubChem CID 70139220) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is ethyl 2-[(3S,10S,13R,17R)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethyl carbonate.
| Compound Name | ethyl 2-[(3S,10S,13R,17R)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethyl carbonate |
|---|---|
| PubChem CID | 70139220 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | ethyl 2-[(3S,10S,13R,17R)-3-hydroxy-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-17-yl]ethyl carbonate |
| SMILES | CCOC(=O)OCC[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C26H40O4/c1-6-29-23(28)30-16-13-17-7-9-19-18-8-10-21-24(2,3)22(27)12-15-26(21,5)20(18)11-14-25(17,19)4/h9,17,21-22,27H,6-8,10-16H2,1-5H3/t17-,21?,22+,25-,26-/m1/s1 |
| InChIKey | SMTAVVBECMMSRA-IAWDSNLNSA-N |
| XLogP | 6.19 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |