C27H42 — CID 174444676
(5R,10S,13R,17S)-4,4,10,13-tetramethyl-17-(3-methylpent-2-enyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 174444676) has the molecular formula C27H42 and a molecular weight of 366.63 g/mol. Its IUPAC name is (5R,10S,13R,17S)-4,4,10,13-tetramethyl-17-(3-methylpent-2-enyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (5R,10S,13R,17S)-4,4,10,13-tetramethyl-17-(3-methylpent-2-enyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 174444676 |
| Molecular Formula | C27H42 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.33 |
| IUPAC Name | (5R,10S,13R,17S)-4,4,10,13-tetramethyl-17-(3-methylpent-2-enyl)-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CCC(C)=CC[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CCCC(C)(C)[C@H]1CC3 |
| InChI | InChI=1S/C27H42/c1-7-19(2)9-10-20-11-13-22-21-12-14-24-25(3,4)16-8-17-27(24,6)23(21)15-18-26(20,22)5/h9,13,20,24H,7-8,10-12,14-18H2,1-6H3/t20-,24+,26+,27+/m0/s1 |
| InChIKey | DKGCUQHUPMNWTC-JGNOEWDTSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|