C33H44O4 — CID 70167702
[(3S,5R,10S,13R,17R)-17-[(2S)-1-acetyloxypropan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 70167702) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is [(3S,5R,10S,13R,17R)-17-[(2S)-1-acetyloxypropan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5R,10S,13R,17R)-17-[(2S)-1-acetyloxypropan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 70167702 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | [(3S,5R,10S,13R,17R)-17-[(2S)-1-acetyloxypropan-2-yl]-4,4,10,13-tetramethyl-1,2,3,5,6,7,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(=O)OC[C@@H](C)[C@H]1CC=C2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](OC(=O)c2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C33H44O4/c1-21(20-36-22(2)34)25-13-14-26-24-12-15-28-31(3,4)29(37-30(35)23-10-8-7-9-11-23)17-19-33(28,6)27(24)16-18-32(25,26)5/h7-11,14,21,25,28-29H,12-13,15-20H2,1-6H3/t21-,25-,28+,29+,32-,33-/m1/s1 |
| InChIKey | OGTKUFZZOHPJFR-NVERWFJQSA-N |
| XLogP | 7.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |