C36H50O5 — CID 142653400
[(3S,5R,10S,13R,14S,17R)-17-[(2S)-3-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13-tetramethyl-15-oxo-2,3,5,6,7,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 142653400) has the molecular formula C36H50O5 and a molecular weight of 562.79 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14S,17R)-17-[(2S)-3-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13-tetramethyl-15-oxo-2,3,5,6,7,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [(3S,5R,10S,13R,14S,17R)-17-[(2S)-3-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13-tetramethyl-15-oxo-2,3,5,6,7,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 142653400 |
| Molecular Formula | C36H50O5 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.37 |
| IUPAC Name | [(3S,5R,10S,13R,14S,17R)-17-[(2S)-3-hydroxy-6-methyl-5-oxoheptan-2-yl]-4,4,10,13-tetramethyl-15-oxo-2,3,5,6,7,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(C)C(=O)CC(O)[C@@H](C)[C@H]1CC(=O)[C@@H]2C3=C(CC[C@@]21C)[C@@]1(C)CC[C@H](OC(=O)c2ccccc2)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C36H50O5/c1-21(2)27(37)20-28(38)22(3)26-19-29(39)32-24-13-14-30-34(4,5)31(41-33(40)23-11-9-8-10-12-23)16-18-35(30,6)25(24)15-17-36(26,32)7/h8-12,21-22,26,28,30-32,38H,13-20H2,1-7H3/t22-,26+,28?,30-,31-,32-,35+,36+/m0/s1 |
| InChIKey | MDLNTJZVPCQVGE-UFDLHBJESA-N |
| XLogP | 7.36 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|