C35H50O3 — CID 139470547
[4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate (PubChem CID 139470547) has the molecular formula C35H50O3 and a molecular weight of 518.78 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate.
| Compound Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 139470547 |
| Molecular Formula | C35H50O3 |
| Molecular Weight | 518.78 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 2-hydroxybenzoate |
| SMILES | CC(C)=CCCCC1CCC2C3=C(CCC12C)C1(C)CCC(OC(=O)c2ccccc2O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C35H50O3/c1-23(2)11-7-8-12-24-15-17-27-25-16-18-30-33(3,4)31(38-32(37)26-13-9-10-14-29(26)36)20-22-35(30,6)28(25)19-21-34(24,27)5/h9-11,13-14,24,27,30-31,36H,7-8,12,15-22H2,1-6H3 |
| InChIKey | UFHJVPHSXUNRBC-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.78 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|