C36H57NO2 — CID 139470521
[4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 8-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 139470521) has the molecular formula C36H57NO2 and a molecular weight of 535.86 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 8-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 8-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 139470521 |
| Molecular Formula | C36H57NO2 |
| Molecular Weight | 535.86 g/mol |
| Exact Mass | 535.44 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 8-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CC(C)=CCCCC1CCC2C3=C(CCC12C)C1(C)CCC(OC(=O)C2CC4CCC(C2)N4)C(C)(C)C1CC3 |
| InChI | InChI=1S/C36H57NO2/c1-23(2)9-7-8-10-25-11-15-29-28-14-16-31-34(3,4)32(18-20-36(31,6)30(28)17-19-35(25,29)5)39-33(38)24-21-26-12-13-27(22-24)37-26/h9,24-27,29,31-32,37H,7-8,10-22H2,1-6H3 |
| InChIKey | PWENIHPIKNPIBB-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.86 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|