C35H54O5 — CID 163064834
2-[3-acetyloxy-4,4,10,13,14-pentamethyl-15-(2-oxopropyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid (PubChem CID 163064834) has the molecular formula C35H54O5 and a molecular weight of 554.81 g/mol. Its IUPAC name is 2-[3-acetyloxy-4,4,10,13,14-pentamethyl-15-(2-oxopropyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid.
| Compound Name | 2-[3-acetyloxy-4,4,10,13,14-pentamethyl-15-(2-oxopropyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 163064834 |
| Molecular Formula | C35H54O5 |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | 2-[3-acetyloxy-4,4,10,13,14-pentamethyl-15-(2-oxopropyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
| SMILES | CC(=O)CC1CC(C(CCC=C(C)C)C(=O)O)C2(C)CCC3=C(CCC4C3(C)CCC(OC(C)=O)C4(C)C)C12C |
| InChI | InChI=1S/C35H54O5/c1-21(2)11-10-12-25(31(38)39)28-20-24(19-22(3)36)35(9)27-13-14-29-32(5,6)30(40-23(4)37)16-17-33(29,7)26(27)15-18-34(28,35)8/h11,24-25,28-30H,10,12-20H2,1-9H3,(H,38,39) |
| InChIKey | JJEXAJFYYBASLT-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|