C32H48O5 — CID 146682773
(2R)-2-[(3R,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,7,11,12,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid (PubChem CID 146682773) has the molecular formula C32H48O5 and a molecular weight of 512.73 g/mol. Its IUPAC name is (2R)-2-[(3R,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,7,11,12,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid.
| Compound Name | (2R)-2-[(3R,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,7,11,12,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 146682773 |
| Molecular Formula | C32H48O5 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (2R)-2-[(3R,5R,10S,13R,14R,17R)-3-acetyloxy-4,4,10,13,14-pentamethyl-16-oxo-1,2,3,5,6,7,11,12,15,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3=C(CC[C@H]2C1(C)C)[C@]1(C)CC(=O)[C@H]([C@@H](CCC=C(C)C)C(=O)O)[C@@]1(C)CC3 |
| InChI | InChI=1S/C32H48O5/c1-19(2)10-9-11-21(28(35)36)27-24(34)18-32(8)23-12-13-25-29(4,5)26(37-20(3)33)15-16-30(25,6)22(23)14-17-31(27,32)7/h10,21,25-27H,9,11-18H2,1-8H3,(H,35,36)/t21-,25+,26-,27+,30-,31-,32+/m1/s1 |
| InChIKey | ASXVTXVWYAWTOQ-STVBAHQGSA-N |
| XLogP | 7.29 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|