C37H60O7 — CID 163123296
1-O-[15-hydroxy-17-(1-hydroxy-6-methylhept-5-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-methyl 3-hydroxy-3-methylpentanedioate (PubChem CID 163123296) has the molecular formula C37H60O7 and a molecular weight of 616.88 g/mol. Its IUPAC name is 1-O-[15-hydroxy-17-(1-hydroxy-6-methylhept-5-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-methyl 3-hydroxy-3-methylpentanedioate.
| Compound Name | 1-O-[15-hydroxy-17-(1-hydroxy-6-methylhept-5-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-methyl 3-hydroxy-3-methylpentanedioate |
|---|---|
| PubChem CID | 163123296 |
| Molecular Formula | C37H60O7 |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 616.43 |
| IUPAC Name | 1-O-[15-hydroxy-17-(1-hydroxy-6-methylhept-5-en-2-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-O-methyl 3-hydroxy-3-methylpentanedioate |
| SMILES | COC(=O)CC(C)(O)CC(=O)OC1CCC2(C)C3=C(CCC2C1(C)C)C1(C)C(O)CC(C(CO)CCC=C(C)C)C1(C)CC3 |
| InChI | InChI=1S/C37H60O7/c1-23(2)11-10-12-24(22-38)27-19-29(39)37(8)26-13-14-28-33(3,4)30(44-32(41)21-34(5,42)20-31(40)43-9)16-17-35(28,6)25(26)15-18-36(27,37)7/h11,24,27-30,38-39,42H,10,12-22H2,1-9H3 |
| InChIKey | CHLVGVZUMKSZKD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|