C32H50O6 — CID 162924634
dimethyl 6-(3,15-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enedioate (PubChem CID 162924634) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is dimethyl 6-(3,15-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enedioate.
| Compound Name | dimethyl 6-(3,15-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enedioate |
|---|---|
| PubChem CID | 162924634 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | dimethyl 6-(3,15-dihydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enedioate |
| SMILES | COC(=O)C(C)=CCCC(C(=O)OC)C1CC(O)C2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C32H50O6/c1-19(27(35)37-7)10-9-11-20(28(36)38-8)23-18-26(34)32(6)22-12-13-24-29(2,3)25(33)15-16-30(24,4)21(22)14-17-31(23,32)5/h10,20,23-26,33-34H,9,11-18H2,1-8H3 |
| InChIKey | MLRHXKRKASWYSR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|