C35H48F2O2 — CID 139470516
[4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,4-difluorobenzoate (PubChem CID 139470516) has the molecular formula C35H48F2O2 and a molecular weight of 538.76 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,4-difluorobenzoate.
| Compound Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 139470516 |
| Molecular Formula | C35H48F2O2 |
| Molecular Weight | 538.76 g/mol |
| Exact Mass | 538.36 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 3,4-difluorobenzoate |
| SMILES | CC(C)=CCCCC1CCC2C3=C(CCC12C)C1(C)CCC(OC(=O)c2ccc(F)c(F)c2)C(C)(C)C1CC3 |
| InChI | InChI=1S/C35H48F2O2/c1-22(2)9-7-8-10-24-12-14-26-25-13-16-30-33(3,4)31(39-32(38)23-11-15-28(36)29(37)21-23)18-20-35(30,6)27(25)17-19-34(24,26)5/h9,11,15,21,24,26,30-31H,7-8,10,12-14,16-20H2,1-6H3 |
| InChIKey | VGFUSYOHXQDUOZ-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.76 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|