C36H49F3O2 — CID 139470505
[4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate (PubChem CID 139470505) has the molecular formula C36H49F3O2 and a molecular weight of 570.78 g/mol. Its IUPAC name is [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 139470505 |
| Molecular Formula | C36H49F3O2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | [4,4,10,13-tetramethyl-17-(5-methylhex-4-enyl)-1,2,3,5,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 4-(trifluoromethyl)benzoate |
| SMILES | CC(C)=CCCCC1CCC2C3=C(CCC12C)C1(C)CCC(OC(=O)c2ccc(C(F)(F)F)cc2)C(C)(C)C1CC3 |
| InChI | InChI=1S/C36H49F3O2/c1-23(2)9-7-8-10-25-15-17-28-27-16-18-30-33(3,4)31(20-22-35(30,6)29(27)19-21-34(25,28)5)41-32(40)24-11-13-26(14-12-24)36(37,38)39/h9,11-14,25,28,30-31H,7-8,10,15-22H2,1-6H3 |
| InChIKey | PKKJTZILPBFRRK-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|