C32H46O5 — CID 121354417
cyclooctyl (4R)-4-[(8R,9S,10R,13R,14S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,8,9,11,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 121354417) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is cyclooctyl (4R)-4-[(8R,9S,10R,13R,14S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,8,9,11,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | cyclooctyl (4R)-4-[(8R,9S,10R,13R,14S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,8,9,11,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 121354417 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | cyclooctyl (4R)-4-[(8R,9S,10R,13R,14S)-10,13-dimethyl-3,7,12-trioxo-1,2,4,8,9,11,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C[C@H](CCC(=O)OC1CCCCCCC1)C1CC[C@H]2[C@@H]3C(=O)C=C4CC(=O)CC[C@]4(C)[C@H]3CC(=O)[C@]12C |
| InChI | InChI=1S/C32H46O5/c1-20(11-14-29(36)37-23-9-7-5-4-6-8-10-23)24-12-13-25-30-26(19-28(35)32(24,25)3)31(2)16-15-22(33)17-21(31)18-27(30)34/h18,20,23-26,30H,4-17,19H2,1-3H3/t20-,24?,25+,26+,30+,31+,32-/m1/s1 |
| InChIKey | HWBDHUGUZXSQPF-KTDVFSNTSA-N |
| XLogP | 6.56 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |