C36H58O4 — CID 101115139
[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 9-oxononanoate (PubChem CID 101115139) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 9-oxononanoate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 9-oxononanoate |
|---|---|
| PubChem CID | 101115139 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-oxo-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] 9-oxononanoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)C=C4C[C@@H](OC(=O)CCCCCCCC=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C36H58O4/c1-25(2)13-12-14-26(3)29-16-17-30-34-31(19-21-36(29,30)5)35(4)20-18-28(23-27(35)24-32(34)38)40-33(39)15-10-8-6-7-9-11-22-37/h22,24-26,28-31,34H,6-21,23H2,1-5H3/t26-,28+,29-,30+,31+,34+,35+,36-/m1/s1 |
| InChIKey | OMXPYSWCEMOLSD-WMZPEDOYSA-N |
| XLogP | 9.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|