C35H56O5 — CID 10231209
9-[[10-methyl-17-(6-methylheptan-2-yl)-7-oxo-2,3,4,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-9-oxononanoic acid (PubChem CID 10231209) has the molecular formula C35H56O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is 9-[[10-methyl-17-(6-methylheptan-2-yl)-7-oxo-2,3,4,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-9-oxononanoic acid.
| Compound Name | 9-[[10-methyl-17-(6-methylheptan-2-yl)-7-oxo-2,3,4,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-9-oxononanoic acid |
|---|---|
| PubChem CID | 10231209 |
| Molecular Formula | C35H56O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | 9-[[10-methyl-17-(6-methylheptan-2-yl)-7-oxo-2,3,4,8,9,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-9-oxononanoic acid |
| SMILES | CC(C)CCCC(C)C1CCC2C1CCC1C2C(=O)C=C2CC(OC(=O)CCCCCCCC(=O)O)CCC21C |
| InChI | InChI=1S/C35H56O5/c1-23(2)11-10-12-24(3)27-15-16-29-28(27)17-18-30-34(29)31(36)22-25-21-26(19-20-35(25,30)4)40-33(39)14-9-7-5-6-8-13-32(37)38/h22-24,26-30,34H,5-21H2,1-4H3,(H,37,38) |
| InChIKey | ZAAJLSXBXCCXAO-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|