C33H58N2O2 — CID 54321466
[10-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-(4-aminobutylamino)propanoate (PubChem CID 54321466) has the molecular formula C33H58N2O2 and a molecular weight of 514.84 g/mol. Its IUPAC name is [10-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-(4-aminobutylamino)propanoate.
| Compound Name | [10-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-(4-aminobutylamino)propanoate |
|---|---|
| PubChem CID | 54321466 |
| Molecular Formula | C33H58N2O2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.45 |
| IUPAC Name | [10-methyl-17-(6-methylheptan-2-yl)-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 3-(4-aminobutylamino)propanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C1CCC1C2CC=C2CC(OC(=O)CCNCCCCN)CCC21C |
| InChI | InChI=1S/C33H58N2O2/c1-23(2)8-7-9-24(3)27-12-13-29-28(27)14-15-31-30(29)11-10-25-22-26(16-18-33(25,31)4)37-32(36)17-21-35-20-6-5-19-34/h10,23-24,26-31,35H,5-9,11-22,34H2,1-4H3 |
| InChIKey | SRZFFUSWIVAUHI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|