C34H51NO2 — CID 129259219
[(3S,8S,10R,17R)-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-2-methylbenzoate (PubChem CID 129259219) has the molecular formula C34H51NO2 and a molecular weight of 505.79 g/mol. Its IUPAC name is [(3S,8S,10R,17R)-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-2-methylbenzoate.
| Compound Name | [(3S,8S,10R,17R)-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-2-methylbenzoate |
|---|---|
| PubChem CID | 129259219 |
| Molecular Formula | C34H51NO2 |
| Molecular Weight | 505.79 g/mol |
| Exact Mass | 505.39 |
| IUPAC Name | [(3S,8S,10R,17R)-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 4-amino-2-methylbenzoate |
| SMILES | Cc1cc(N)ccc1C(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3C4CC[C@H]([C@H](C)CCCC(C)C)C4CCC32)C1 |
| InChI | InChI=1S/C34H51NO2/c1-21(2)7-6-8-22(3)27-13-14-30-29(27)15-16-32-31(30)11-9-24-20-26(17-18-34(24,32)5)37-33(36)28-12-10-25(35)19-23(28)4/h9-10,12,19,21-22,26-27,29-32H,6-8,11,13-18,20,35H2,1-5H3/t22-,26+,27-,29?,30?,31+,32?,34+/m1/s1 |
| InChIKey | HTXVDGZSIWHTJI-KXYDDDAZSA-N |
| XLogP | 8.75 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.79 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|