C36H53NO4 — CID 22846187
4-(aminomethyl)-2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]benzoic acid (PubChem CID 22846187) has the molecular formula C36H53NO4 and a molecular weight of 563.82 g/mol. Its IUPAC name is 4-(aminomethyl)-2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]benzoic acid.
| Compound Name | 4-(aminomethyl)-2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 22846187 |
| Molecular Formula | C36H53NO4 |
| Molecular Weight | 563.82 g/mol |
| Exact Mass | 563.40 |
| IUPAC Name | 4-(aminomethyl)-2-[[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonyl]benzoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3CC=C4CC(OC(=O)c5cc(CN)ccc5C(=O)O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C36H53NO4/c1-22(2)7-6-8-23(3)30-13-14-31-28-12-10-25-20-26(15-17-35(25,4)32(28)16-18-36(30,31)5)41-34(40)29-19-24(21-37)9-11-27(29)33(38)39/h9-11,19,22-23,26,28,30-32H,6-8,12-18,20-21,37H2,1-5H3,(H,38,39)/t23-,26?,28?,30-,31?,32?,35+,36-/m1/s1 |
| InChIKey | QIHYCGLIEGELKD-LVVFAEOHSA-N |
| XLogP | 8.41 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.82 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|