C27H50O — CID 171817052
(3S,8S,10R,13R,17R)-3-methoxy-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene;molecular hydrogen (PubChem CID 171817052) has the molecular formula C27H50O and a molecular weight of 390.70 g/mol. Its IUPAC name is (3S,8S,10R,13R,17R)-3-methoxy-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene;molecular hydrogen.
| Compound Name | (3S,8S,10R,13R,17R)-3-methoxy-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene;molecular hydrogen |
|---|---|
| PubChem CID | 171817052 |
| Molecular Formula | C27H50O |
| Molecular Weight | 390.70 g/mol |
| Exact Mass | 390.39 |
| IUPAC Name | (3S,8S,10R,13R,17R)-3-methoxy-10-methyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,7,8,9,11,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene;molecular hydrogen |
| SMILES | CO[C@H]1CC[C@@]2(C)C(=CC[C@H]3C4CC[C@H]([C@H](C)CCCC(C)C)[C@H]4CCC32)C1.[H][H].[H][H] |
| InChI | InChI=1S/C27H46O.2H2/c1-18(2)7-6-8-19(3)22-11-12-24-23(22)13-14-26-25(24)10-9-20-17-21(28-5)15-16-27(20,26)4;;/h9,18-19,21-26H,6-8,10-17H2,1-5H3;2*1H/t19-,21+,22-,23-,24?,25+,26?,27+;;/m1../s1 |
| InChIKey | VQDGVWYKPGSHRC-MXGQSHRTSA-N |
| XLogP | 8.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.70 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|