C36H59NO — CID 54136129
N,4-dimethylaniline;(10R,13R)-3-methoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 54136129) has the molecular formula C36H59NO and a molecular weight of 521.87 g/mol. Its IUPAC name is N,4-dimethylaniline;(10R,13R)-3-methoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | N,4-dimethylaniline;(10R,13R)-3-methoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 54136129 |
| Molecular Formula | C36H59NO |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.46 |
| IUPAC Name | N,4-dimethylaniline;(10R,13R)-3-methoxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CNc1ccc(C)cc1.COC1CC[C@@]2(C)C(=CCC3C4CCC(C(C)CCCC(C)C)[C@@]4(C)CCC32)C1 |
| InChI | InChI=1S/C28H48O.C8H11N/c1-19(2)8-7-9-20(3)24-12-13-25-23-11-10-21-18-22(29-6)14-16-27(21,4)26(23)15-17-28(24,25)5;1-7-3-5-8(9-2)6-4-7/h10,19-20,22-26H,7-9,11-18H2,1-6H3;3-6,9H,1-2H3/t20?,22?,23?,24?,25?,26?,27-,28+;/m0./s1 |
| InChIKey | NXUUZTWFNSDMEY-RMIOPMPOSA-N |
| XLogP | 10.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|