C33H56O4Si — CID 54170027
(4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-oxo-3-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 54170027) has the molecular formula C33H56O4Si and a molecular weight of 544.89 g/mol. Its IUPAC name is (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-oxo-3-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-oxo-3-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 54170027 |
| Molecular Formula | C33H56O4Si |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.39 |
| IUPAC Name | (4R)-4-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-7-oxo-3-tri(propan-2-yl)silyloxy-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CC(C)[Si](O[C@H]1CC[C@@]2(C)C(=CC(=O)[C@H]3[C@@H]4CC[C@H]([C@H](C)CCC(=O)O)[C@@]4(C)CC[C@@H]32)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H56O4Si/c1-20(2)38(21(3)4,22(5)6)37-25-14-16-32(8)24(18-25)19-29(34)31-27-12-11-26(23(7)10-13-30(35)36)33(27,9)17-15-28(31)32/h19-23,25-28,31H,10-18H2,1-9H3,(H,35,36)/t23-,25+,26-,27+,28+,31+,32+,33-/m1/s1 |
| InChIKey | OUIYSMPDNSVCFV-KGBGALGJSA-N |
| XLogP | 8.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|