C24H38O2 — CID 145169184
methyl (4R)-4-[(14R)-10-methyl-1,2,3,4,5,6,7,8,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 145169184) has the molecular formula C24H38O2 and a molecular weight of 358.57 g/mol. Its IUPAC name is methyl (4R)-4-[(14R)-10-methyl-1,2,3,4,5,6,7,8,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(14R)-10-methyl-1,2,3,4,5,6,7,8,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 145169184 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | methyl (4R)-4-[(14R)-10-methyl-1,2,3,4,5,6,7,8,12,13,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)C1CC[C@H]2C3CCC4CCCCC4(C)C3=CCC12 |
| InChI | InChI=1S/C24H38O2/c1-16(7-14-23(25)26-3)18-10-11-20-19(18)12-13-22-21(20)9-8-17-6-4-5-15-24(17,22)2/h13,16-21H,4-12,14-15H2,1-3H3/t16-,17?,18?,19?,20-,21?,24?/m1/s1 |
| InChIKey | NREBXESVAUEQHH-QSXOLQQJSA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|