C31H50O3 — CID 67924091
ethyl 2-[(3S,5S,10S,13R,14R,17S)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,17-decahydrocyclopenta[a]phenanthren-14-yl]acetate (PubChem CID 67924091) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is ethyl 2-[(3S,5S,10S,13R,14R,17S)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,17-decahydrocyclopenta[a]phenanthren-14-yl]acetate.
| Compound Name | ethyl 2-[(3S,5S,10S,13R,14R,17S)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,17-decahydrocyclopenta[a]phenanthren-14-yl]acetate |
|---|---|
| PubChem CID | 67924091 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | ethyl 2-[(3S,5S,10S,13R,14R,17S)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,6,7,11,12,17-decahydrocyclopenta[a]phenanthren-14-yl]acetate |
| SMILES | CCOC(=O)C[C@@]12C=C[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CCC1=C2CC[C@H]2C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C31H50O3/c1-7-34-28(33)20-31-18-15-25(22(4)10-8-9-21(2)3)30(31,6)17-14-26-27(31)12-11-23-19-24(32)13-16-29(23,26)5/h15,18,21-25,32H,7-14,16-17,19-20H2,1-6H3/t22-,23+,24+,25-,29+,30-,31-/m1/s1 |
| InChIKey | PEFRLUUICGADTG-DYVAFQJZSA-N |
| XLogP | 7.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|