C29H38O5 — CID 123440312
[17-(1-acetyloxyethyl)-13-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate (PubChem CID 123440312) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is [17-(1-acetyloxyethyl)-13-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate.
| Compound Name | [17-(1-acetyloxyethyl)-13-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
|---|---|
| PubChem CID | 123440312 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [17-(1-acetyloxyethyl)-13-hydroxy-10-methyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] benzoate |
| SMILES | CC(=O)OC(C)C1CC=C2C3CCC4CC(OC(=O)c5ccccc5)CCC4(C)C3CCC21O |
| InChI | InChI=1S/C29H38O5/c1-18(33-19(2)30)24-11-12-26-23-10-9-21-17-22(34-27(31)20-7-5-4-6-8-20)13-15-28(21,3)25(23)14-16-29(24,26)32/h4-8,12,18,21-25,32H,9-11,13-17H2,1-3H3 |
| InChIKey | YVZWHYFUHQKPQM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|