C28H38O5 — CID 56847262
1-[[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl acetate (PubChem CID 56847262) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 1-[[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl acetate.
| Compound Name | 1-[[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl acetate |
|---|---|
| PubChem CID | 56847262 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]ethyl acetate |
| SMILES | CC(=O)OC(C)O[C@H]1CC[C@@]2(C)[C@H](CC[C@H]3C4=CC[C@H](c5ccc(=O)oc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H38O5/c1-17(29)32-18(2)33-21-11-13-27(3)20(15-21)6-7-22-24-9-8-23(19-5-10-26(30)31-16-19)28(24,4)14-12-25(22)27/h5,9-10,16,18,20-23,25H,6-8,11-15H2,1-4H3/t18?,20-,21+,22+,23-,25+,27+,28-/m1/s1 |
| InChIKey | RKBVHFJOFGZLHF-VTOHVPSPSA-N |
| XLogP | 5.98 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|