C29H40N2O4 — CID 66611644
[10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-aminopyrrolidine-1-carboxylate (PubChem CID 66611644) has the molecular formula C29H40N2O4 and a molecular weight of 480.65 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-aminopyrrolidine-1-carboxylate.
| Compound Name | [10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-aminopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66611644 |
| Molecular Formula | C29H40N2O4 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | [10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-aminopyrrolidine-1-carboxylate |
| SMILES | CC12CCC3C(CCC4CC(OC(=O)N5CCC(N)C5)CCC43C)C1=CCC2c1ccc(=O)oc1 |
| InChI | InChI=1S/C29H40N2O4/c1-28-12-9-21(35-27(33)31-14-11-20(30)16-31)15-19(28)4-5-22-24-7-6-23(18-3-8-26(32)34-17-18)29(24,2)13-10-25(22)28/h3,7-8,17,19-23,25H,4-6,9-16,30H2,1-2H3 |
| InChIKey | AUUPWPYJXBUJMI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|