C30H41NO5 — CID 56847571
[(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-3-hydroxypiperidine-1-carboxylate (PubChem CID 56847571) has the molecular formula C30H41NO5 and a molecular weight of 495.66 g/mol. Its IUPAC name is [(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | [(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 56847571 |
| Molecular Formula | C30H41NO5 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | [(3S,5R,8R,9S,10S,13R,17S)-10,13-dimethyl-17-(6-oxopyran-3-yl)-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (3R)-3-hydroxypiperidine-1-carboxylate |
| SMILES | C[C@]12CC[C@H](OC(=O)N3CCC[C@@H](O)C3)C[C@H]1CC[C@H]1C3=CC[C@H](c4ccc(=O)oc4)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C30H41NO5/c1-29-13-11-22(36-28(34)31-15-3-4-21(32)17-31)16-20(29)6-7-23-25-9-8-24(19-5-10-27(33)35-18-19)30(25,2)14-12-26(23)29/h5,9-10,18,20-24,26,32H,3-4,6-8,11-17H2,1-2H3/t20-,21-,22+,23+,24-,26+,29+,30-/m1/s1 |
| InChIKey | MQBWAUJWUFTHQQ-KHQFZVFFSA-N |
| XLogP | 5.65 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|